C17H19N5O2 — CID 167799793
(3R)-1-prop-2-enoyl-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]piperidine-3-carboxamide (PubChem CID 167799793) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (3R)-1-prop-2-enoyl-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-prop-2-enoyl-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 167799793 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3R)-1-prop-2-enoyl-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]piperidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](C(=O)Nc2ccccc2-c2ncn[nH]2)C1 |
| InChI | InChI=1S/C17H19N5O2/c1-2-15(23)22-9-5-6-12(10-22)17(24)20-14-8-4-3-7-13(14)16-18-11-19-21-16/h2-4,7-8,11-12H,1,5-6,9-10H2,(H,20,24)(H,18,19,21)/t12-/m1/s1 |
| InChIKey | PRJBLMZSAPSPDG-GFCCVEGCSA-N |
| XLogP | 1.83 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|