C17H19N5O2S — CID 166287455
1-prop-2-enoyl-N'-(3-sulfanylidene-4H-quinoxalin-2-yl)piperidine-3-carbohydrazide (PubChem CID 166287455) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-prop-2-enoyl-N'-(3-sulfanylidene-4H-quinoxalin-2-yl)piperidine-3-carbohydrazide.
| Compound Name | 1-prop-2-enoyl-N'-(3-sulfanylidene-4H-quinoxalin-2-yl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 166287455 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-prop-2-enoyl-N'-(3-sulfanylidene-4H-quinoxalin-2-yl)piperidine-3-carbohydrazide |
| SMILES | C=CC(=O)N1CCCC(C(=O)NNc2nc3ccccc3[nH]c2=S)C1 |
| InChI | InChI=1S/C17H19N5O2S/c1-2-14(23)22-9-5-6-11(10-22)16(24)21-20-15-17(25)19-13-8-4-3-7-12(13)18-15/h2-4,7-8,11H,1,5-6,9-10H2,(H,18,20)(H,19,25)(H,21,24) |
| InChIKey | COWYTEIWRNLHNL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|