C16H19ClFNO3 — CID 99970364
2-chloro-N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-fluorobenzamide (PubChem CID 99970364) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is 2-chloro-N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 99970364 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-chloro-N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-fluorobenzamide |
| SMILES | O=C(N[C@@H]1CCOC2(CCOCC2)C1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H19ClFNO3/c17-14-9-11(18)1-2-13(14)15(20)19-12-3-6-22-16(10-12)4-7-21-8-5-16/h1-2,9,12H,3-8,10H2,(H,19,20)/t12-/m1/s1 |
| InChIKey | RGFYPVLZNIGUNS-GFCCVEGCSA-N |
| XLogP | 2.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |