C15H17ClFNO3 — CID 136537063
3-chloro-5-fluoro-4-hydroxy-N-(5-oxaspiro[3.5]nonan-8-yl)benzamide (PubChem CID 136537063) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is 3-chloro-5-fluoro-4-hydroxy-N-(5-oxaspiro[3.5]nonan-8-yl)benzamide.
| Compound Name | 3-chloro-5-fluoro-4-hydroxy-N-(5-oxaspiro[3.5]nonan-8-yl)benzamide |
|---|---|
| PubChem CID | 136537063 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-chloro-5-fluoro-4-hydroxy-N-(5-oxaspiro[3.5]nonan-8-yl)benzamide |
| SMILES | O=C(NC1CCOC2(CCC2)C1)c1cc(F)c(O)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClFNO3/c16-11-6-9(7-12(17)13(11)19)14(20)18-10-2-5-21-15(8-10)3-1-4-15/h6-7,10,19H,1-5,8H2,(H,18,20) |
| InChIKey | RJELYALERYCKSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |