C17H21NO5 — CID 129468061
3-[[(5S,9R)-2,6-dioxaspiro[4.5]decan-9-yl]carbamoyl]-5-methylbenzoic acid (PubChem CID 129468061) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-[[(5S,9R)-2,6-dioxaspiro[4.5]decan-9-yl]carbamoyl]-5-methylbenzoic acid.
| Compound Name | 3-[[(5S,9R)-2,6-dioxaspiro[4.5]decan-9-yl]carbamoyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 129468061 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-[[(5S,9R)-2,6-dioxaspiro[4.5]decan-9-yl]carbamoyl]-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)N[C@@H]2CCO[C@]3(CCOC3)C2)c1 |
| InChI | InChI=1S/C17H21NO5/c1-11-6-12(8-13(7-11)16(20)21)15(19)18-14-2-4-23-17(9-14)3-5-22-10-17/h6-8,14H,2-5,9-10H2,1H3,(H,18,19)(H,20,21)/t14-,17-/m1/s1 |
| InChIKey | BNUFPPGEHMDDBP-RHSMWYFYSA-N |
| XLogP | 1.76 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |