C23H31N3O6 — CID 166196304
2-N,6-N-bis(2,6-dioxaspiro[4.5]decan-9-yl)pyridine-2,6-dicarboxamide (PubChem CID 166196304) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-N,6-N-bis(2,6-dioxaspiro[4.5]decan-9-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(2,6-dioxaspiro[4.5]decan-9-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 166196304 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-N,6-N-bis(2,6-dioxaspiro[4.5]decan-9-yl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NC1CCOC2(CCOC2)C1)c1cccc(C(=O)NC2CCOC3(CCOC3)C2)n1 |
| InChI | InChI=1S/C23H31N3O6/c27-20(24-16-4-8-31-22(12-16)6-10-29-14-22)18-2-1-3-19(26-18)21(28)25-17-5-9-32-23(13-17)7-11-30-15-23/h1-3,16-17H,4-15H2,(H,24,27)(H,25,28) |
| InChIKey | NGJABJXFNDXQEH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |