C18H22N2O5S — CID 97255507
N-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-4-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 97255507) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-4-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-4-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 97255507 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-4-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCO[C@@]3(CCOC3)C2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-2-9-19-26(22,23)16-5-3-14(4-6-16)17(21)20-15-7-10-25-18(12-15)8-11-24-13-18/h1,3-6,15,19H,7-13H2,(H,20,21)/t15-,18+/m1/s1 |
| InChIKey | HCMNARAIZNGYKH-QAPCUYQASA-N |
| XLogP | 0.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|