C16H19ClF2N2O2 — CID 97076162
1-(2-chloro-4,5-difluorophenyl)-3-[(9R)-6-oxaspiro[4.5]decan-9-yl]urea (PubChem CID 97076162) has the molecular formula C16H19ClF2N2O2 and a molecular weight of 344.79 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3-[(9R)-6-oxaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3-[(9R)-6-oxaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 97076162 |
| Molecular Formula | C16H19ClF2N2O2 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3-[(9R)-6-oxaspiro[4.5]decan-9-yl]urea |
| SMILES | O=C(Nc1cc(F)c(F)cc1Cl)N[C@@H]1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C16H19ClF2N2O2/c17-11-7-12(18)13(19)8-14(11)21-15(22)20-10-3-6-23-16(9-10)4-1-2-5-16/h7-8,10H,1-6,9H2,(H2,20,21,22)/t10-/m1/s1 |
| InChIKey | PFCKUGROZHTCGR-SNVBAGLBSA-N |
| XLogP | 4.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|