C9H16N2O2 — CID 131086736
5-oxaspiro[3.5]nonan-8-ylurea (PubChem CID 131086736) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-oxaspiro[3.5]nonan-8-ylurea.
| Compound Name | 5-oxaspiro[3.5]nonan-8-ylurea |
|---|---|
| PubChem CID | 131086736 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-oxaspiro[3.5]nonan-8-ylurea |
| SMILES | NC(=O)NC1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C9H16N2O2/c10-8(12)11-7-2-5-13-9(6-7)3-1-4-9/h7H,1-6H2,(H3,10,11,12) |
| InChIKey | PINIDZYZKSWPIG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |