C17H30N2O3 — CID 97235034
1-[(1S)-1-(oxan-4-yl)ethyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea (PubChem CID 97235034) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(1S)-1-(oxan-4-yl)ethyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-[(1S)-1-(oxan-4-yl)ethyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 97235034 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-[(1S)-1-(oxan-4-yl)ethyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
| SMILES | C[C@H](NC(=O)N[C@H]1CCOC2(CCCC2)C1)C1CCOCC1 |
| InChI | InChI=1S/C17H30N2O3/c1-13(14-4-9-21-10-5-14)18-16(20)19-15-6-11-22-17(12-15)7-2-3-8-17/h13-15H,2-12H2,1H3,(H2,18,19,20)/t13-,15-/m0/s1 |
| InChIKey | BFKAHWKQDJLVGB-ZFWWWQNUSA-N |
| XLogP | 2.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |