C19H30N2O3 — CID 124888728
1-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea (PubChem CID 124888728) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 124888728 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
| SMILES | Cc1ccc(CC[C@H](C)NC(=O)N[C@H]2CCOC3(CCCC3)C2)o1 |
| InChI | InChI=1S/C19H30N2O3/c1-14(5-7-17-8-6-15(2)24-17)20-18(22)21-16-9-12-23-19(13-16)10-3-4-11-19/h6,8,14,16H,3-5,7,9-13H2,1-2H3,(H2,20,21,22)/t14-,16-/m0/s1 |
| InChIKey | SOUZPEQBTYYHAE-HOCLYGCPSA-N |
| XLogP | 3.70 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |