C17H26N2O2S — CID 97234998
1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-[(2R)-2-thiophen-3-ylpropyl]urea (PubChem CID 97234998) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-[(2R)-2-thiophen-3-ylpropyl]urea.
| Compound Name | 1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-[(2R)-2-thiophen-3-ylpropyl]urea |
|---|---|
| PubChem CID | 97234998 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-[(2R)-2-thiophen-3-ylpropyl]urea |
| SMILES | C[C@@H](CNC(=O)N[C@H]1CCOC2(CCCC2)C1)c1ccsc1 |
| InChI | InChI=1S/C17H26N2O2S/c1-13(14-5-9-22-12-14)11-18-16(20)19-15-4-8-21-17(10-15)6-2-3-7-17/h5,9,12-13,15H,2-4,6-8,10-11H2,1H3,(H2,18,19,20)/t13-,15-/m0/s1 |
| InChIKey | BKYVSDNIXIYOQQ-ZFWWWQNUSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |