C15H23NO3S — CID 106435314
2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-1-thiophen-3-ylethanol (PubChem CID 106435314) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-1-thiophen-3-ylethanol.
| Compound Name | 2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435314 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-1-thiophen-3-ylethanol |
| SMILES | OC(CNC1CCOC2(CCOCC2)C1)c1ccsc1 |
| InChI | InChI=1S/C15H23NO3S/c17-14(12-2-8-20-11-12)10-16-13-1-5-19-15(9-13)3-6-18-7-4-15/h2,8,11,13-14,16-17H,1,3-7,9-10H2 |
| InChIKey | SSBALRASBBZRTD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |