C13H20N2O3S — CID 106435490
4-(aminomethyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxane-4-carboxamide (PubChem CID 106435490) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 106435490 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-(aminomethyl)-N-(2-hydroxy-2-thiophen-3-ylethyl)oxane-4-carboxamide |
| SMILES | NCC1(C(=O)NCC(O)c2ccsc2)CCOCC1 |
| InChI | InChI=1S/C13H20N2O3S/c14-9-13(2-4-18-5-3-13)12(17)15-7-11(16)10-1-6-19-8-10/h1,6,8,11,16H,2-5,7,9,14H2,(H,15,17) |
| InChIKey | ZDJBECBNZZAJAC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |