C12H18N2O2S — CID 113269287
N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpyrrolidine-2-carboxamide (PubChem CID 113269287) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 113269287 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-methylpyrrolidine-2-carboxamide |
| SMILES | CC1(C(=O)NCC(O)c2ccsc2)CCCN1 |
| InChI | InChI=1S/C12H18N2O2S/c1-12(4-2-5-14-12)11(16)13-7-10(15)9-3-6-17-8-9/h3,6,8,10,14-15H,2,4-5,7H2,1H3,(H,13,16) |
| InChIKey | JIZWHLLJVUVZAD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |