C18H25ClN2O3 — CID 128676663
1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,9-dioxaspiro[5.5]undecan-4-yl)urea (PubChem CID 128676663) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,9-dioxaspiro[5.5]undecan-4-yl)urea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,9-dioxaspiro[5.5]undecan-4-yl)urea |
|---|---|
| PubChem CID | 128676663 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,9-dioxaspiro[5.5]undecan-4-yl)urea |
| SMILES | C[C@H](NC(=O)NC1CCOC2(CCOCC2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-13(14-2-4-15(19)5-3-14)20-17(22)21-16-6-9-24-18(12-16)7-10-23-11-8-18/h2-5,13,16H,6-12H2,1H3,(H2,20,21,22)/t13-,16?/m0/s1 |
| InChIKey | IXYVZZIGLJECOF-KNVGNIICSA-N |
| XLogP | 3.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |