C18H25NO4 — CID 129345943
N-[(4S)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-methoxy-2-methylbenzamide (PubChem CID 129345943) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[(4S)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-methoxy-2-methylbenzamide.
| Compound Name | N-[(4S)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-methoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 129345943 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[(4S)-1,9-dioxaspiro[5.5]undecan-4-yl]-4-methoxy-2-methylbenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCOC3(CCOCC3)C2)c(C)c1 |
| InChI | InChI=1S/C18H25NO4/c1-13-11-15(21-2)3-4-16(13)17(20)19-14-5-8-23-18(12-14)6-9-22-10-7-18/h3-4,11,14H,5-10,12H2,1-2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | ZYEPRXQPRIACCS-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |