C16H22FNO2S — CID 107033933
N-(2,2-diethyloxan-4-yl)-2-fluoro-5-sulfanylbenzamide (PubChem CID 107033933) has the molecular formula C16H22FNO2S and a molecular weight of 311.42 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107033933 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-2-fluoro-5-sulfanylbenzamide |
| SMILES | CCC1(CC)CC(NC(=O)c2cc(S)ccc2F)CCO1 |
| InChI | InChI=1S/C16H22FNO2S/c1-3-16(4-2)10-11(7-8-20-16)18-15(19)13-9-12(21)5-6-14(13)17/h5-6,9,11,21H,3-4,7-8,10H2,1-2H3,(H,18,19) |
| InChIKey | LZKXYHOUJIJQFV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|