C16H22BrNO2 — CID 82760145
4-bromo-N-(2,2-diethyloxan-4-yl)benzamide (PubChem CID 82760145) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 4-bromo-N-(2,2-diethyloxan-4-yl)benzamide.
| Compound Name | 4-bromo-N-(2,2-diethyloxan-4-yl)benzamide |
|---|---|
| PubChem CID | 82760145 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-bromo-N-(2,2-diethyloxan-4-yl)benzamide |
| SMILES | CCC1(CC)CC(NC(=O)c2ccc(Br)cc2)CCO1 |
| InChI | InChI=1S/C16H22BrNO2/c1-3-16(4-2)11-14(9-10-20-16)18-15(19)12-5-7-13(17)8-6-12/h5-8,14H,3-4,9-11H2,1-2H3,(H,18,19) |
| InChIKey | VTAXPIQJLNTGDU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |