C16H21BrFNO2 — CID 82765218
4-bromo-N-(2,2-diethyloxan-4-yl)-3-fluorobenzamide (PubChem CID 82765218) has the molecular formula C16H21BrFNO2 and a molecular weight of 358.25 g/mol. Its IUPAC name is 4-bromo-N-(2,2-diethyloxan-4-yl)-3-fluorobenzamide.
| Compound Name | 4-bromo-N-(2,2-diethyloxan-4-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 82765218 |
| Molecular Formula | C16H21BrFNO2 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-bromo-N-(2,2-diethyloxan-4-yl)-3-fluorobenzamide |
| SMILES | CCC1(CC)CC(NC(=O)c2ccc(Br)c(F)c2)CCO1 |
| InChI | InChI=1S/C16H21BrFNO2/c1-3-16(4-2)10-12(7-8-21-16)19-15(20)11-5-6-13(17)14(18)9-11/h5-6,9,12H,3-4,7-8,10H2,1-2H3,(H,19,20) |
| InChIKey | NRFQHOMNNWBWTI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |