C15H19ClO3S — CID 79893844
[5-chloro-2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)phenyl]methanol (PubChem CID 79893844) has the molecular formula C15H19ClO3S and a molecular weight of 314.83 g/mol. Its IUPAC name is [5-chloro-2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)phenyl]methanol.
| Compound Name | [5-chloro-2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 79893844 |
| Molecular Formula | C15H19ClO3S |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [5-chloro-2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)phenyl]methanol |
| SMILES | OCc1cc(Cl)ccc1OC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H19ClO3S/c16-12-1-2-14(11(7-12)9-17)19-13-3-5-18-15(8-13)4-6-20-10-15/h1-2,7,13,17H,3-6,8-10H2 |
| InChIKey | LVWCNSJCJJCHEI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |