C16H22ClNO2S — CID 79899571
[5-chloro-2-(1-oxa-9-thiaspiro[5.5]undecan-4-yloxy)phenyl]methanamine (PubChem CID 79899571) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is [5-chloro-2-(1-oxa-9-thiaspiro[5.5]undecan-4-yloxy)phenyl]methanamine.
| Compound Name | [5-chloro-2-(1-oxa-9-thiaspiro[5.5]undecan-4-yloxy)phenyl]methanamine |
|---|---|
| PubChem CID | 79899571 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [5-chloro-2-(1-oxa-9-thiaspiro[5.5]undecan-4-yloxy)phenyl]methanamine |
| SMILES | NCc1cc(Cl)ccc1OC1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C16H22ClNO2S/c17-13-1-2-15(12(9-13)11-18)20-14-3-6-19-16(10-14)4-7-21-8-5-16/h1-2,9,14H,3-8,10-11,18H2 |
| InChIKey | NAVRISMXPNRONN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |