C17H24O2S — CID 81005535
4-(2,5-dimethylphenoxy)-1-oxa-9-thiaspiro[5.5]undecane (PubChem CID 81005535) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is 4-(2,5-dimethylphenoxy)-1-oxa-9-thiaspiro[5.5]undecane.
| Compound Name | 4-(2,5-dimethylphenoxy)-1-oxa-9-thiaspiro[5.5]undecane |
|---|---|
| PubChem CID | 81005535 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-(2,5-dimethylphenoxy)-1-oxa-9-thiaspiro[5.5]undecane |
| SMILES | Cc1ccc(C)c(OC2CCOC3(CCSCC3)C2)c1 |
| InChI | InChI=1S/C17H24O2S/c1-13-3-4-14(2)16(11-13)19-15-5-8-18-17(12-15)6-9-20-10-7-17/h3-4,11,15H,5-10,12H2,1-2H3 |
| InChIKey | DMKAFEDZZCVUIU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |