C17H23NO3 — CID 79909247
6-oxaspiro[4.5]decan-9-yl 4-amino-2-methylbenzoate (PubChem CID 79909247) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-oxaspiro[4.5]decan-9-yl 4-amino-2-methylbenzoate.
| Compound Name | 6-oxaspiro[4.5]decan-9-yl 4-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 79909247 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-oxaspiro[4.5]decan-9-yl 4-amino-2-methylbenzoate |
| SMILES | Cc1cc(N)ccc1C(=O)OC1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H23NO3/c1-12-10-13(18)4-5-15(12)16(19)21-14-6-9-20-17(11-14)7-2-3-8-17/h4-5,10,14H,2-3,6-9,11,18H2,1H3 |
| InChIKey | MXFHLAIVQYNGBM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|