C17H22O4 — CID 79901924
4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-3,5-dimethylbenzaldehyde (PubChem CID 79901924) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-3,5-dimethylbenzaldehyde.
| Compound Name | 4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 79901924 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-3,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1OC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C17H22O4/c1-12-7-14(10-18)8-13(2)16(12)21-15-3-5-20-17(9-15)4-6-19-11-17/h7-8,10,15H,3-6,9,11H2,1-2H3 |
| InChIKey | SIACRDLALXLXAM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|