C15H17Cl3O3 — CID 79899968
9-[2,4-dichloro-6-(chloromethyl)phenoxy]-2,6-dioxaspiro[4.5]decane (PubChem CID 79899968) has the molecular formula C15H17Cl3O3 and a molecular weight of 351.66 g/mol. Its IUPAC name is 9-[2,4-dichloro-6-(chloromethyl)phenoxy]-2,6-dioxaspiro[4.5]decane.
| Compound Name | 9-[2,4-dichloro-6-(chloromethyl)phenoxy]-2,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 79899968 |
| Molecular Formula | C15H17Cl3O3 |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 9-[2,4-dichloro-6-(chloromethyl)phenoxy]-2,6-dioxaspiro[4.5]decane |
| SMILES | ClCc1cc(Cl)cc(Cl)c1OC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H17Cl3O3/c16-8-10-5-11(17)6-13(18)14(10)21-12-1-3-20-15(7-12)2-4-19-9-15/h5-6,12H,1-4,7-9H2 |
| InChIKey | ZSXOLHWWSNYVQD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|