C16H21BrO4 — CID 79899075
[3-bromo-2-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol (PubChem CID 79899075) has the molecular formula C16H21BrO4 and a molecular weight of 357.24 g/mol. Its IUPAC name is [3-bromo-2-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol.
| Compound Name | [3-bromo-2-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 79899075 |
| Molecular Formula | C16H21BrO4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | [3-bromo-2-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol |
| SMILES | OCc1cccc(Br)c1OC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H21BrO4/c17-14-3-1-2-12(11-18)15(14)21-13-4-7-20-16(10-13)5-8-19-9-6-16/h1-3,13,18H,4-11H2 |
| InChIKey | CGJPVAPJVNKFQI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |