C16H22O4 — CID 79894680
[3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol (PubChem CID 79894680) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is [3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol.
| Compound Name | [3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 79894680 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)phenyl]methanol |
| SMILES | OCc1cccc(OC2CCOC3(CCOCC3)C2)c1 |
| InChI | InChI=1S/C16H22O4/c17-12-13-2-1-3-14(10-13)20-15-4-7-19-16(11-15)5-8-18-9-6-16/h1-3,10,15,17H,4-9,11-12H2 |
| InChIKey | YFTPUFAPCHCXES-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |