C16H19NO3 — CID 79905653
3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)benzonitrile (PubChem CID 79905653) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)benzonitrile.
| Compound Name | 3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 79905653 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3-(1,9-dioxaspiro[5.5]undecan-4-yloxy)benzonitrile |
| SMILES | N#Cc1cccc(OC2CCOC3(CCOCC3)C2)c1 |
| InChI | InChI=1S/C16H19NO3/c17-12-13-2-1-3-14(10-13)20-15-4-7-19-16(11-15)5-8-18-9-6-16/h1-3,10,15H,4-9,11H2 |
| InChIKey | BAGYAUMWBAWEGL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |