C15H20BrNO3 — CID 103588032
3-bromo-5-(1,9-dioxaspiro[5.5]undecan-4-yloxy)aniline (PubChem CID 103588032) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is 3-bromo-5-(1,9-dioxaspiro[5.5]undecan-4-yloxy)aniline.
| Compound Name | 3-bromo-5-(1,9-dioxaspiro[5.5]undecan-4-yloxy)aniline |
|---|---|
| PubChem CID | 103588032 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-bromo-5-(1,9-dioxaspiro[5.5]undecan-4-yloxy)aniline |
| SMILES | Nc1cc(Br)cc(OC2CCOC3(CCOCC3)C2)c1 |
| InChI | InChI=1S/C15H20BrNO3/c16-11-7-12(17)9-14(8-11)20-13-1-4-19-15(10-13)2-5-18-6-3-15/h7-9,13H,1-6,10,17H2 |
| InChIKey | PPWDEHHXJXPYCP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|