C14H17BF3KO2 — CID 79900555
potassium trifluoro-[3-(5-oxaspiro[3.5]nonan-8-yloxy)phenyl]boranuide (PubChem CID 79900555) has the molecular formula C14H17BF3KO2 and a molecular weight of 324.19 g/mol. Its IUPAC name is potassium trifluoro-[3-(5-oxaspiro[3.5]nonan-8-yloxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[3-(5-oxaspiro[3.5]nonan-8-yloxy)phenyl]boranuide |
|---|---|
| PubChem CID | 79900555 |
| Molecular Formula | C14H17BF3KO2 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | potassium trifluoro-[3-(5-oxaspiro[3.5]nonan-8-yloxy)phenyl]boranuide |
| SMILES | F[B-](F)(F)c1cccc(OC2CCOC3(CCC3)C2)c1.[K+] |
| InChI | InChI=1S/C14H17BF3O2.K/c16-15(17,18)11-3-1-4-12(9-11)20-13-5-8-19-14(10-13)6-2-7-14;/h1,3-4,9,13H,2,5-8,10H2;/q-1;+1 |
| InChIKey | CTXGUGUQHKPZHQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|