C22H33BO4 — CID 113252337
4,4,5,5-tetramethyl-2-[3-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]-1,3,2-dioxaborolane (PubChem CID 113252337) has the molecular formula C22H33BO4 and a molecular weight of 372.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 113252337 |
| Molecular Formula | C22H33BO4 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(OC3CCOC4(CCCCC4)C3)c2)OC1(C)C |
| InChI | InChI=1S/C22H33BO4/c1-20(2)21(3,4)27-23(26-20)17-9-8-10-18(15-17)25-19-11-14-24-22(16-19)12-6-5-7-13-22/h8-10,15,19H,5-7,11-14,16H2,1-4H3 |
| InChIKey | UNBNULBNLUBWFV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|