C12H21NO3 — CID 79920646
1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-ol (PubChem CID 79920646) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-ol.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 79920646 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-ol |
| SMILES | OC1CN(C2CCOC3(CCOCC3)C2)C1 |
| InChI | InChI=1S/C12H21NO3/c14-11-8-13(9-11)10-1-4-16-12(7-10)2-5-15-6-3-12/h10-11,14H,1-9H2 |
| InChIKey | XSWRNSGZIXCNDH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |