C17H24N2O2 — CID 70717623
2-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-yl]pyridine (PubChem CID 70717623) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-yl]pyridine.
| Compound Name | 2-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-yl]pyridine |
|---|---|
| PubChem CID | 70717623 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)azetidin-3-yl]pyridine |
| SMILES | c1ccc(C2CN(C3CCOC4(CCOCC4)C3)C2)nc1 |
| InChI | InChI=1S/C17H24N2O2/c1-2-7-18-16(3-1)14-12-19(13-14)15-4-8-21-17(11-15)5-9-20-10-6-17/h1-3,7,14-15H,4-6,8-13H2 |
| InChIKey | QYUVAUAQIAMGTQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |