C20H23N5O2 — CID 154821785
4-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)imidazol-2-yl]-1-phenyltriazole (PubChem CID 154821785) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)imidazol-2-yl]-1-phenyltriazole.
| Compound Name | 4-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)imidazol-2-yl]-1-phenyltriazole |
|---|---|
| PubChem CID | 154821785 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-[1-(1,9-dioxaspiro[5.5]undecan-4-yl)imidazol-2-yl]-1-phenyltriazole |
| SMILES | c1ccc(-n2cc(-c3nccn3C3CCOC4(CCOCC4)C3)nn2)cc1 |
| InChI | InChI=1S/C20H23N5O2/c1-2-4-16(5-3-1)25-15-18(22-23-25)19-21-9-10-24(19)17-6-11-27-20(14-17)7-12-26-13-8-20/h1-5,9-10,15,17H,6-8,11-14H2 |
| InChIKey | HMVHHGFMOCPOOJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |