C12H19N3O2 — CID 79903246
1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazol-3-amine (PubChem CID 79903246) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazol-3-amine.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 79903246 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazol-3-amine |
| SMILES | Nc1ccn(C2CCOC3(CCOCC3)C2)n1 |
| InChI | InChI=1S/C12H19N3O2/c13-11-1-5-15(14-11)10-2-6-17-12(9-10)3-7-16-8-4-12/h1,5,10H,2-4,6-9H2,(H2,13,14) |
| InChIKey | OEIIAMMOJUZSSK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |