C13H18N2O4 — CID 79893701
1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazole-4-carboxylic acid (PubChem CID 79893701) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79893701 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(C2CCOC3(CCOCC3)C2)c1 |
| InChI | InChI=1S/C13H18N2O4/c16-12(17)10-8-14-15(9-10)11-1-4-19-13(7-11)2-5-18-6-3-13/h8-9,11H,1-7H2,(H,16,17) |
| InChIKey | OHTUJIWVBBKKLI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |