C12H17N3O4 — CID 107461399
2-[1-(2,6-dioxaspiro[4.5]decan-9-yl)triazol-4-yl]acetic acid (PubChem CID 107461399) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[1-(2,6-dioxaspiro[4.5]decan-9-yl)triazol-4-yl]acetic acid.
| Compound Name | 2-[1-(2,6-dioxaspiro[4.5]decan-9-yl)triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461399 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[1-(2,6-dioxaspiro[4.5]decan-9-yl)triazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(C2CCOC3(CCOC3)C2)nn1 |
| InChI | InChI=1S/C12H17N3O4/c16-11(17)5-9-7-15(14-13-9)10-1-3-19-12(6-10)2-4-18-8-12/h7,10H,1-6,8H2,(H,16,17) |
| InChIKey | KJWXJKVKXHQTHE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |