C9H15BF3O2- — CID 79920073
1,9-dioxaspiro[5.5]undecan-4-yl(trifluoro)boranuide (PubChem CID 79920073) has the molecular formula C9H15BF3O2- and a molecular weight of 223.02 g/mol. Its IUPAC name is 1,9-dioxaspiro[5.5]undecan-4-yl(trifluoro)boranuide.
| Compound Name | 1,9-dioxaspiro[5.5]undecan-4-yl(trifluoro)boranuide |
|---|---|
| PubChem CID | 79920073 |
| Molecular Formula | C9H15BF3O2- |
| Molecular Weight | 223.02 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1,9-dioxaspiro[5.5]undecan-4-yl(trifluoro)boranuide |
| SMILES | F[B-](F)(F)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C9H15BF3O2/c11-10(12,13)8-1-4-15-9(7-8)2-5-14-6-3-9/h8H,1-7H2/q-1 |
| InChIKey | VUGPMJDQOSSOCV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.02 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|