C9H16O2 — CID 177019737
9-methyl-2,6-dioxaspiro[4.5]decane (PubChem CID 177019737) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 9-methyl-2,6-dioxaspiro[4.5]decane.
| Compound Name | 9-methyl-2,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 177019737 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 9-methyl-2,6-dioxaspiro[4.5]decane |
| SMILES | CC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C9H16O2/c1-8-2-4-11-9(6-8)3-5-10-7-9/h8H,2-7H2,1H3 |
| InChIKey | OIWCCFCMYIJHLE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |