C14H23ClO2 — CID 79923916
9-(3-chloro-2-methylcyclopentyl)-2,6-dioxaspiro[4.5]decane (PubChem CID 79923916) has the molecular formula C14H23ClO2 and a molecular weight of 258.79 g/mol. Its IUPAC name is 9-(3-chloro-2-methylcyclopentyl)-2,6-dioxaspiro[4.5]decane.
| Compound Name | 9-(3-chloro-2-methylcyclopentyl)-2,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 79923916 |
| Molecular Formula | C14H23ClO2 |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 9-(3-chloro-2-methylcyclopentyl)-2,6-dioxaspiro[4.5]decane |
| SMILES | CC1C(Cl)CCC1C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C14H23ClO2/c1-10-12(2-3-13(10)15)11-4-6-17-14(8-11)5-7-16-9-14/h10-13H,2-9H2,1H3 |
| InChIKey | CQPZHJREOODIMS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|