C15H25ClO2 — CID 79919791
4-(2-chlorocyclohexyl)-1,9-dioxaspiro[5.5]undecane (PubChem CID 79919791) has the molecular formula C15H25ClO2 and a molecular weight of 272.82 g/mol. Its IUPAC name is 4-(2-chlorocyclohexyl)-1,9-dioxaspiro[5.5]undecane.
| Compound Name | 4-(2-chlorocyclohexyl)-1,9-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79919791 |
| Molecular Formula | C15H25ClO2 |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-(2-chlorocyclohexyl)-1,9-dioxaspiro[5.5]undecane |
| SMILES | ClC1CCCCC1C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H25ClO2/c16-14-4-2-1-3-13(14)12-5-8-18-15(11-12)6-9-17-10-7-15/h12-14H,1-11H2 |
| InChIKey | DALJWSWBTNSCKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|