C13H16O2 — CID 163386607
4-methylspiro[3,4-dihydrochromene-2,3'-oxolane] (PubChem CID 163386607) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-methylspiro[3,4-dihydrochromene-2,3'-oxolane].
| Compound Name | 4-methylspiro[3,4-dihydrochromene-2,3'-oxolane] |
|---|---|
| PubChem CID | 163386607 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-methylspiro[3,4-dihydrochromene-2,3'-oxolane] |
| SMILES | CC1CC2(CCOC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H16O2/c1-10-8-13(6-7-14-9-13)15-12-5-3-2-4-11(10)12/h2-5,10H,6-9H2,1H3 |
| InChIKey | JOGISJAGZVFAKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |