C8H15NO2 — CID 96936602
(5R,7S)-7-methyl-2,6-dioxa-9-azaspiro[4.5]decane (PubChem CID 96936602) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (5R,7S)-7-methyl-2,6-dioxa-9-azaspiro[4.5]decane.
| Compound Name | (5R,7S)-7-methyl-2,6-dioxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 96936602 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (5R,7S)-7-methyl-2,6-dioxa-9-azaspiro[4.5]decane |
| SMILES | C[C@H]1CNC[C@@]2(CCOC2)O1 |
| InChI | InChI=1S/C8H15NO2/c1-7-4-9-5-8(11-7)2-3-10-6-8/h7,9H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | PTBMPLQSWYVVMM-JGVFFNPUSA-N |
| XLogP | 0.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |