C7H13F2NO — CID 125424449
(2R,6R)-2-(difluoromethyl)-2,6-dimethylmorpholine (PubChem CID 125424449) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is (2R,6R)-2-(difluoromethyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-2-(difluoromethyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 125424449 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2R,6R)-2-(difluoromethyl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CNC[C@](C)(C(F)F)O1 |
| InChI | InChI=1S/C7H13F2NO/c1-5-3-10-4-7(2,11-5)6(8)9/h5-6,10H,3-4H2,1-2H3/t5-,7-/m1/s1 |
| InChIKey | FMBDLFMQDZFLHC-IYSWYEEDSA-N |
| XLogP | 1.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |