C10H16I2O2 — CID 135041897
(2R)-2,9-bis(iodomethyl)-1,10-dioxaspiro[4.5]decane (PubChem CID 135041897) has the molecular formula C10H16I2O2 and a molecular weight of 422.04 g/mol. Its IUPAC name is (2R)-2,9-bis(iodomethyl)-1,10-dioxaspiro[4.5]decane.
| Compound Name | (2R)-2,9-bis(iodomethyl)-1,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 135041897 |
| Molecular Formula | C10H16I2O2 |
| Molecular Weight | 422.04 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | (2R)-2,9-bis(iodomethyl)-1,10-dioxaspiro[4.5]decane |
| SMILES | ICC1CCCC2(CC[C@H](CI)O2)O1 |
| InChI | InChI=1S/C10H16I2O2/c11-6-8-2-1-4-10(13-8)5-3-9(7-12)14-10/h8-9H,1-7H2/t8?,9-,10?/m1/s1 |
| InChIKey | OFBLESIASAOURS-HWOCKDDLSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.04 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|