C11H17IO — CID 130582614
5'-(iodomethyl)spiro[bicyclo[4.1.0]heptane-2,2'-oxolane] (PubChem CID 130582614) has the molecular formula C11H17IO and a molecular weight of 292.16 g/mol. Its IUPAC name is 5'-(iodomethyl)spiro[bicyclo[4.1.0]heptane-2,2'-oxolane].
| Compound Name | 5'-(iodomethyl)spiro[bicyclo[4.1.0]heptane-2,2'-oxolane] |
|---|---|
| PubChem CID | 130582614 |
| Molecular Formula | C11H17IO |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5'-(iodomethyl)spiro[bicyclo[4.1.0]heptane-2,2'-oxolane] |
| SMILES | ICC1CCC2(CCCC3CC32)O1 |
| InChI | InChI=1S/C11H17IO/c12-7-9-3-5-11(13-9)4-1-2-8-6-10(8)11/h8-10H,1-7H2 |
| InChIKey | KMRGESSJTUUMHJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|