C12H19IO — CID 130583136
5'-(iodomethyl)-5'-methylspiro[bicyclo[4.1.0]heptane-2,2'-oxolane] (PubChem CID 130583136) has the molecular formula C12H19IO and a molecular weight of 306.19 g/mol. Its IUPAC name is 5'-(iodomethyl)-5'-methylspiro[bicyclo[4.1.0]heptane-2,2'-oxolane].
| Compound Name | 5'-(iodomethyl)-5'-methylspiro[bicyclo[4.1.0]heptane-2,2'-oxolane] |
|---|---|
| PubChem CID | 130583136 |
| Molecular Formula | C12H19IO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5'-(iodomethyl)-5'-methylspiro[bicyclo[4.1.0]heptane-2,2'-oxolane] |
| SMILES | CC1(CI)CCC2(CCCC3CC32)O1 |
| InChI | InChI=1S/C12H19IO/c1-11(8-13)5-6-12(14-11)4-2-3-9-7-10(9)12/h9-10H,2-8H2,1H3 |
| InChIKey | OMTXOQKIGVJTPL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|