About 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane
2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane (PubChem CID 130583379) has the molecular formula C12H21IO
and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane.
Molecular Properties
| Compound Name | 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane |
| PubChem CID | 130583379 |
| Molecular Formula | C12H21IO |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane |
| SMILES | CC1(CI)CCC(C)(C2CCCC2)O1 |
| InChI | InChI=1S/C12H21IO/c1-11(9-13)7-8-12(2,14-11)10-5-3-4-6-10/h10H,3-9H2,1-2H3 |
| InChIKey | NGUQZSCHLPSQSM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane?
The IUPAC name of 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane (CID 130583379) is 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane.
What is the SMILES notation for 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane?
The canonical SMILES for 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane is CC1(CI)CCC(C)(C2CCCC2)O1.
What is the InChIKey of 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane?
The InChIKey is NGUQZSCHLPSQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21IO/c1-11(9-13)7-8-12(2,14-11)10-5-3-4-6-10/h10H,3-9H2,1-2H3.
What are the key properties of 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane?
2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane has a molecular weight of 308.20 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-5-(iodomethyl)-2,5-dimethyloxolane is sourced from PubChem (CID 130583379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).