C12H21BrO — CID 130583351
2-(bromomethyl)-5-cyclopentyl-2,5-dimethyloxolane (PubChem CID 130583351) has the molecular formula C12H21BrO and a molecular weight of 261.20 g/mol. Its IUPAC name is 2-(bromomethyl)-5-cyclopentyl-2,5-dimethyloxolane.
| Compound Name | 2-(bromomethyl)-5-cyclopentyl-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 130583351 |
| Molecular Formula | C12H21BrO |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(bromomethyl)-5-cyclopentyl-2,5-dimethyloxolane |
| SMILES | CC1(CBr)CCC(C)(C2CCCC2)O1 |
| InChI | InChI=1S/C12H21BrO/c1-11(9-13)7-8-12(2,14-11)10-5-3-4-6-10/h10H,3-9H2,1-2H3 |
| InChIKey | WWBXBDKJZQMFEH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|